C13H17F3N2O — CID 175262358
2,2-dimethyl-1-[3-(trifluoromethoxy)phenyl]piperazine (PubChem CID 175262358) has the molecular formula C13H17F3N2O and a molecular weight of 274.29 g/mol. Its IUPAC name is 2,2-dimethyl-1-[3-(trifluoromethoxy)phenyl]piperazine.
| Compound Name | 2,2-dimethyl-1-[3-(trifluoromethoxy)phenyl]piperazine |
|---|---|
| PubChem CID | 175262358 |
| Molecular Formula | C13H17F3N2O |
| Molecular Weight | 274.29 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 2,2-dimethyl-1-[3-(trifluoromethoxy)phenyl]piperazine |
| SMILES | CC1(C)CNCCN1c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C13H17F3N2O/c1-12(2)9-17-6-7-18(12)10-4-3-5-11(8-10)19-13(14,15)16/h3-5,8,17H,6-7,9H2,1-2H3 |
| InChIKey | BBBOBBSXLXPYLD-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.29 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |