C23H16Cl2N2O3 — CID 175264830
4-[2-[[4-chloro-3-(3-chloro-5-cyanophenyl)phenyl]methylamino]-2-oxoethyl]benzoic acid (PubChem CID 175264830) has the molecular formula C23H16Cl2N2O3 and a molecular weight of 439.30 g/mol. Its IUPAC name is 4-[2-[[4-chloro-3-(3-chloro-5-cyanophenyl)phenyl]methylamino]-2-oxoethyl]benzoic acid.
| Compound Name | 4-[2-[[4-chloro-3-(3-chloro-5-cyanophenyl)phenyl]methylamino]-2-oxoethyl]benzoic acid |
|---|---|
| PubChem CID | 175264830 |
| Molecular Formula | C23H16Cl2N2O3 |
| Molecular Weight | 439.30 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | 4-[2-[[4-chloro-3-(3-chloro-5-cyanophenyl)phenyl]methylamino]-2-oxoethyl]benzoic acid |
| SMILES | N#Cc1cc(Cl)cc(-c2cc(CNC(=O)Cc3ccc(C(=O)O)cc3)ccc2Cl)c1 |
| InChI | InChI=1S/C23H16Cl2N2O3/c24-19-8-16(12-26)7-18(11-19)20-9-15(3-6-21(20)25)13-27-22(28)10-14-1-4-17(5-2-14)23(29)30/h1-9,11H,10,13H2,(H,27,28)(H,29,30) |
| InChIKey | WKTFBMHPSCGOTR-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.30 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |