C14H23FN2O3S — CID 175265108
tert-butyl formate;[2-(4-fluoropiperidin-4-yl)-1,3-thiazol-5-yl]methanol (PubChem CID 175265108) has the molecular formula C14H23FN2O3S and a molecular weight of 318.41 g/mol. Its IUPAC name is tert-butyl formate;[2-(4-fluoropiperidin-4-yl)-1,3-thiazol-5-yl]methanol.
| Compound Name | tert-butyl formate;[2-(4-fluoropiperidin-4-yl)-1,3-thiazol-5-yl]methanol |
|---|---|
| PubChem CID | 175265108 |
| Molecular Formula | C14H23FN2O3S |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | tert-butyl formate;[2-(4-fluoropiperidin-4-yl)-1,3-thiazol-5-yl]methanol |
| SMILES | CC(C)(C)OC=O.OCc1cnc(C2(F)CCNCC2)s1 |
| InChI | InChI=1S/C9H13FN2OS.C5H10O2/c10-9(1-3-11-4-2-9)8-12-5-7(6-13)14-8;1-5(2,3)7-4-6/h5,11,13H,1-4,6H2;4H,1-3H3 |
| InChIKey | LWSOLUAMEFGNCB-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|