C15H13BrF3NO2 — CID 175265270
4-bromo-N-[1-[2-(trifluoromethyl)phenyl]propyl]furan-2-carboxamide (PubChem CID 175265270) has the molecular formula C15H13BrF3NO2 and a molecular weight of 376.17 g/mol. Its IUPAC name is 4-bromo-N-[1-[2-(trifluoromethyl)phenyl]propyl]furan-2-carboxamide.
| Compound Name | 4-bromo-N-[1-[2-(trifluoromethyl)phenyl]propyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 175265270 |
| Molecular Formula | C15H13BrF3NO2 |
| Molecular Weight | 376.17 g/mol |
| Exact Mass | 375.01 |
| IUPAC Name | 4-bromo-N-[1-[2-(trifluoromethyl)phenyl]propyl]furan-2-carboxamide |
| SMILES | CCC(NC(=O)c1cc(Br)co1)c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C15H13BrF3NO2/c1-2-12(20-14(21)13-7-9(16)8-22-13)10-5-3-4-6-11(10)15(17,18)19/h3-8,12H,2H2,1H3,(H,20,21) |
| InChIKey | QWEVEZCRUKHMLR-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.17 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |