C19H30O2 — CID 175265755
3,3-dicyclopentyl-2-(cyclopentylmethyl)prop-2-enoic acid (PubChem CID 175265755) has the molecular formula C19H30O2 and a molecular weight of 290.45 g/mol. Its IUPAC name is 3,3-dicyclopentyl-2-(cyclopentylmethyl)prop-2-enoic acid.
| Compound Name | 3,3-dicyclopentyl-2-(cyclopentylmethyl)prop-2-enoic acid |
|---|---|
| PubChem CID | 175265755 |
| Molecular Formula | C19H30O2 |
| Molecular Weight | 290.45 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | 3,3-dicyclopentyl-2-(cyclopentylmethyl)prop-2-enoic acid |
| SMILES | O=C(O)C(CC1CCCC1)=C(C1CCCC1)C1CCCC1 |
| InChI | InChI=1S/C19H30O2/c20-19(21)17(13-14-7-1-2-8-14)18(15-9-3-4-10-15)16-11-5-6-12-16/h14-16H,1-13H2,(H,20,21) |
| InChIKey | JCMVNUZUJQCLKG-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.45 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|