C8H17N2O3P — CID 175266048
5-ethyl-2-methyl-1H-imidazole;methoxy(methyl)phosphinic acid (PubChem CID 175266048) has the molecular formula C8H17N2O3P and a molecular weight of 220.21 g/mol. Its IUPAC name is 5-ethyl-2-methyl-1H-imidazole;methoxy(methyl)phosphinic acid.
| Compound Name | 5-ethyl-2-methyl-1H-imidazole;methoxy(methyl)phosphinic acid |
|---|---|
| PubChem CID | 175266048 |
| Molecular Formula | C8H17N2O3P |
| Molecular Weight | 220.21 g/mol |
| Exact Mass | 220.10 |
| IUPAC Name | 5-ethyl-2-methyl-1H-imidazole;methoxy(methyl)phosphinic acid |
| SMILES | CCc1cnc(C)[nH]1.COP(C)(=O)O |
| InChI | InChI=1S/C6H10N2.C2H7O3P/c1-3-6-4-7-5(2)8-6;1-5-6(2,3)4/h4H,3H2,1-2H3,(H,7,8);1-2H3,(H,3,4) |
| InChIKey | XAKGOSVOZACSQX-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.21 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|