About 1,1-dipropoxycyclononane;thiophen-2-ylmethylphosphane;hydroiodide
1,1-dipropoxycyclononane;thiophen-2-ylmethylphosphane;hydroiodide (PubChem CID 175266669) has the molecular formula C20H38IO2PS
and a molecular weight of 500.47 g/mol. Its IUPAC name is 1,1-dipropoxycyclononane;thiophen-2-ylmethylphosphane;hydroiodide.
Molecular Properties
| Compound Name | 1,1-dipropoxycyclononane;thiophen-2-ylmethylphosphane;hydroiodide |
| PubChem CID | 175266669 |
| Molecular Formula | C20H38IO2PS |
| Molecular Weight | 500.47 g/mol |
| Exact Mass | 500.14 |
| IUPAC Name | 1,1-dipropoxycyclononane;thiophen-2-ylmethylphosphane;hydroiodide |
| SMILES | CCCOC1(OCCC)CCCCCCCC1.I.PCc1cccs1 |
| InChI | InChI=1S/C15H30O2.C5H7PS.HI/c1-3-13-16-15(17-14-4-2)11-9-7-5-6-8-10-12-15;6-4-5-2-1-3-7-5;/h3-14H2,1-2H3;1-3H,4,6H2;1H |
| InChIKey | GIJIAKRWQRYFAT-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 500.47 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dipropoxycyclononane;thiophen-2-ylmethylphosphane;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dipropoxycyclononane;thiophen-2-ylmethylphosphane;hydroiodide?
The IUPAC name of 1,1-dipropoxycyclononane;thiophen-2-ylmethylphosphane;hydroiodide (CID 175266669) is 1,1-dipropoxycyclononane;thiophen-2-ylmethylphosphane;hydroiodide.
What is the SMILES notation for 1,1-dipropoxycyclononane;thiophen-2-ylmethylphosphane;hydroiodide?
The canonical SMILES for 1,1-dipropoxycyclononane;thiophen-2-ylmethylphosphane;hydroiodide is CCCOC1(OCCC)CCCCCCCC1.I.PCc1cccs1.
What is the InChIKey of 1,1-dipropoxycyclononane;thiophen-2-ylmethylphosphane;hydroiodide?
The InChIKey is GIJIAKRWQRYFAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30O2.C5H7PS.HI/c1-3-13-16-15(17-14-4-2)11-9-7-5-6-8-10-12-15;6-4-5-2-1-3-7-5;/h3-14H2,1-2H3;1-3H,4,6H2;1H.
What are the key properties of 1,1-dipropoxycyclononane;thiophen-2-ylmethylphosphane;hydroiodide?
1,1-dipropoxycyclononane;thiophen-2-ylmethylphosphane;hydroiodide has a molecular weight of 500.47 g/mol, XLogP of 7.41, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dipropoxycyclononane;thiophen-2-ylmethylphosphane;hydroiodide is sourced from PubChem (CID 175266669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).