C27H44N2O4 — CID 175267219
2-[amino(nonanoyl)amino]-3-phenylpropanoic acid;2-pentylcyclobutan-1-one (PubChem CID 175267219) has the molecular formula C27H44N2O4 and a molecular weight of 460.66 g/mol. Its IUPAC name is 2-[amino(nonanoyl)amino]-3-phenylpropanoic acid;2-pentylcyclobutan-1-one.
| Compound Name | 2-[amino(nonanoyl)amino]-3-phenylpropanoic acid;2-pentylcyclobutan-1-one |
|---|---|
| PubChem CID | 175267219 |
| Molecular Formula | C27H44N2O4 |
| Molecular Weight | 460.66 g/mol |
| Exact Mass | 460.33 |
| IUPAC Name | 2-[amino(nonanoyl)amino]-3-phenylpropanoic acid;2-pentylcyclobutan-1-one |
| SMILES | CCCCCC1CCC1=O.CCCCCCCCC(=O)N(N)C(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C18H28N2O3.C9H16O/c1-2-3-4-5-6-10-13-17(21)20(19)16(18(22)23)14-15-11-8-7-9-12-15;1-2-3-4-5-8-6-7-9(8)10/h7-9,11-12,16H,2-6,10,13-14,19H2,1H3,(H,22,23);8H,2-7H2,1H3 |
| InChIKey | GTIYCIPMCXVAIY-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.66 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|