C14H18O6 — CID 175267230
4-(3,4-dihydroxy-6-oxohexoxy)-3-methoxybenzaldehyde (PubChem CID 175267230) has the molecular formula C14H18O6 and a molecular weight of 282.29 g/mol. Its IUPAC name is 4-(3,4-dihydroxy-6-oxohexoxy)-3-methoxybenzaldehyde.
| Compound Name | 4-(3,4-dihydroxy-6-oxohexoxy)-3-methoxybenzaldehyde |
|---|---|
| PubChem CID | 175267230 |
| Molecular Formula | C14H18O6 |
| Molecular Weight | 282.29 g/mol |
| Exact Mass | 282.11 |
| IUPAC Name | 4-(3,4-dihydroxy-6-oxohexoxy)-3-methoxybenzaldehyde |
| SMILES | COc1cc(C=O)ccc1OCCC(O)C(O)CC=O |
| InChI | InChI=1S/C14H18O6/c1-19-14-8-10(9-16)2-3-13(14)20-7-5-12(18)11(17)4-6-15/h2-3,6,8-9,11-12,17-18H,4-5,7H2,1H3 |
| InChIKey | UGICKNXEPAQXCS-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.29 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|