C14H12N2 — CID 175267365
2-(3-pyridin-3-ylbuta-1,2-dienyl)pyridine (PubChem CID 175267365) has the molecular formula C14H12N2 and a molecular weight of 208.26 g/mol. Its IUPAC name is 2-(3-pyridin-3-ylbuta-1,2-dienyl)pyridine.
| Compound Name | 2-(3-pyridin-3-ylbuta-1,2-dienyl)pyridine |
|---|---|
| PubChem CID | 175267365 |
| Molecular Formula | C14H12N2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 2-(3-pyridin-3-ylbuta-1,2-dienyl)pyridine |
| SMILES | CC(=C=Cc1ccccn1)c1cccnc1 |
| InChI | InChI=1S/C14H12N2/c1-12(13-5-4-9-15-11-13)7-8-14-6-2-3-10-16-14/h2-6,8-11H,1H3 |
| InChIKey | MCYCKPLGJQGVBV-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |