C17H19N3 — CID 4601342
2-(2-piperidin-1-yl-2-pyridin-3-ylethenyl)pyridine (PubChem CID 4601342) has the molecular formula C17H19N3 and a molecular weight of 265.36 g/mol. Its IUPAC name is 2-(2-piperidin-1-yl-2-pyridin-3-ylethenyl)pyridine.
| Compound Name | 2-(2-piperidin-1-yl-2-pyridin-3-ylethenyl)pyridine |
|---|---|
| PubChem CID | 4601342 |
| Molecular Formula | C17H19N3 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.16 |
| IUPAC Name | 2-(2-piperidin-1-yl-2-pyridin-3-ylethenyl)pyridine |
| SMILES | C(=C(c1cccnc1)N1CCCCC1)c1ccccn1 |
| InChI | InChI=1S/C17H19N3/c1-4-11-20(12-5-1)17(15-7-6-9-18-14-15)13-16-8-2-3-10-19-16/h2-3,6-10,13-14H,1,4-5,11-12H2 |
| InChIKey | FRLFBOCRNONITH-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |