C20H22BrF3N2O — CID 175268906
1-[2-[2-bromo-5-(trifluoromethyl)phenyl]ethyl]-1-ethyl-3-(2-phenylethyl)urea (PubChem CID 175268906) has the molecular formula C20H22BrF3N2O and a molecular weight of 443.31 g/mol. Its IUPAC name is 1-[2-[2-bromo-5-(trifluoromethyl)phenyl]ethyl]-1-ethyl-3-(2-phenylethyl)urea.
| Compound Name | 1-[2-[2-bromo-5-(trifluoromethyl)phenyl]ethyl]-1-ethyl-3-(2-phenylethyl)urea |
|---|---|
| PubChem CID | 175268906 |
| Molecular Formula | C20H22BrF3N2O |
| Molecular Weight | 443.31 g/mol |
| Exact Mass | 442.09 |
| IUPAC Name | 1-[2-[2-bromo-5-(trifluoromethyl)phenyl]ethyl]-1-ethyl-3-(2-phenylethyl)urea |
| SMILES | CCN(CCc1cc(C(F)(F)F)ccc1Br)C(=O)NCCc1ccccc1 |
| InChI | InChI=1S/C20H22BrF3N2O/c1-2-26(19(27)25-12-10-15-6-4-3-5-7-15)13-11-16-14-17(20(22,23)24)8-9-18(16)21/h3-9,14H,2,10-13H2,1H3,(H,25,27) |
| InChIKey | MIEBQKOSVDLJRR-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.31 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |