C17H26BrN3O2 — CID 48964163
2-[2-(2-bromophenyl)ethylcarbamoyl-ethylamino]-N-tert-butylacetamide (PubChem CID 48964163) has the molecular formula C17H26BrN3O2 and a molecular weight of 384.32 g/mol. Its IUPAC name is 2-[2-(2-bromophenyl)ethylcarbamoyl-ethylamino]-N-tert-butylacetamide.
| Compound Name | 2-[2-(2-bromophenyl)ethylcarbamoyl-ethylamino]-N-tert-butylacetamide |
|---|---|
| PubChem CID | 48964163 |
| Molecular Formula | C17H26BrN3O2 |
| Molecular Weight | 384.32 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 2-[2-(2-bromophenyl)ethylcarbamoyl-ethylamino]-N-tert-butylacetamide |
| SMILES | CCN(CC(=O)NC(C)(C)C)C(=O)NCCc1ccccc1Br |
| InChI | InChI=1S/C17H26BrN3O2/c1-5-21(12-15(22)20-17(2,3)4)16(23)19-11-10-13-8-6-7-9-14(13)18/h6-9H,5,10-12H2,1-4H3,(H,19,23)(H,20,22) |
| InChIKey | VWPYRJRSYHMZEM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.32 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |