C16H14BrNO2 — CID 175268961
benzyl 5-bromo-2,3-dihydro-1H-indole-2-carboxylate (PubChem CID 175268961) has the molecular formula C16H14BrNO2 and a molecular weight of 332.20 g/mol. Its IUPAC name is benzyl 5-bromo-2,3-dihydro-1H-indole-2-carboxylate.
| Compound Name | benzyl 5-bromo-2,3-dihydro-1H-indole-2-carboxylate |
|---|---|
| PubChem CID | 175268961 |
| Molecular Formula | C16H14BrNO2 |
| Molecular Weight | 332.20 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | benzyl 5-bromo-2,3-dihydro-1H-indole-2-carboxylate |
| SMILES | O=C(OCc1ccccc1)C1Cc2cc(Br)ccc2N1 |
| InChI | InChI=1S/C16H14BrNO2/c17-13-6-7-14-12(8-13)9-15(18-14)16(19)20-10-11-4-2-1-3-5-11/h1-8,15,18H,9-10H2 |
| InChIKey | UIVFGWKKAQMMKI-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.20 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |