ethane-1,2-diol;2-fluoro-2-(4-nitrophenyl)acetic acid

C10H12FNO6 — CID 175270208

IUPACethane-1,2-diol;2-fluoro-2-(4-nitrophenyl)acetic acid
SMILESO=C(O)C(F)c1ccc([N+](=O)[O-])cc1.OCCO
InChIInChI=1S/C8H6FNO4.C2H6O2/c9-7(8(11)12)5-1-3-6(4-2-5)10(13)14;3-1-2-4/h1-4,7H,(H,11,12);3-4H,1-2H2
InChIKeyURFAYUGDIWNWLY-UHFFFAOYSA-N
MW261.20 g/mol
LogP0.66
Rot. Bonds4

About ethane-1,2-diol;2-fluoro-2-(4-nitrophenyl)acetic acid

ethane-1,2-diol;2-fluoro-2-(4-nitrophenyl)acetic acid (PubChem CID 175270208) has the molecular formula C10H12FNO6 and a molecular weight of 261.20 g/mol. Its IUPAC name is ethane-1,2-diol;2-fluoro-2-(4-nitrophenyl)acetic acid.

Molecular Properties

Compound Nameethane-1,2-diol;2-fluoro-2-(4-nitrophenyl)acetic acid
PubChem CID175270208
Molecular FormulaC10H12FNO6
Molecular Weight261.20 g/mol
Exact Mass261.06
IUPAC Nameethane-1,2-diol;2-fluoro-2-(4-nitrophenyl)acetic acid
SMILESO=C(O)C(F)c1ccc([N+](=O)[O-])cc1.OCCO
InChIInChI=1S/C8H6FNO4.C2H6O2/c9-7(8(11)12)5-1-3-6(4-2-5)10(13)14;3-1-2-4/h1-4,7H,(H,11,12);3-4H,1-2H2
InChIKeyURFAYUGDIWNWLY-UHFFFAOYSA-N
XLogP0.66
TPSA120.90 Ų
H-Bond Donors3
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500261.20
LogP ≤ 50.66
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze ethane-1,2-diol;2-fluoro-2-(4-nitrophenyl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethane-1,2-diol;2-fluoro-2-(4-nitrophenyl)acetic acid?
The IUPAC name of ethane-1,2-diol;2-fluoro-2-(4-nitrophenyl)acetic acid (CID 175270208) is ethane-1,2-diol;2-fluoro-2-(4-nitrophenyl)acetic acid.
What is the SMILES notation for ethane-1,2-diol;2-fluoro-2-(4-nitrophenyl)acetic acid?
The canonical SMILES for ethane-1,2-diol;2-fluoro-2-(4-nitrophenyl)acetic acid is O=C(O)C(F)c1ccc([N+](=O)[O-])cc1.OCCO.
What is the InChIKey of ethane-1,2-diol;2-fluoro-2-(4-nitrophenyl)acetic acid?
The InChIKey is URFAYUGDIWNWLY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H6FNO4.C2H6O2/c9-7(8(11)12)5-1-3-6(4-2-5)10(13)14;3-1-2-4/h1-4,7H,(H,11,12);3-4H,1-2H2.
What are the key properties of ethane-1,2-diol;2-fluoro-2-(4-nitrophenyl)acetic acid?
ethane-1,2-diol;2-fluoro-2-(4-nitrophenyl)acetic acid has a molecular weight of 261.20 g/mol, XLogP of 0.66, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane-1,2-diol;2-fluoro-2-(4-nitrophenyl)acetic acid is sourced from PubChem (CID 175270208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).