C10H12FNO6 — CID 175270208
ethane-1,2-diol;2-fluoro-2-(4-nitrophenyl)acetic acid (PubChem CID 175270208) has the molecular formula C10H12FNO6 and a molecular weight of 261.20 g/mol. Its IUPAC name is ethane-1,2-diol;2-fluoro-2-(4-nitrophenyl)acetic acid.
| Compound Name | ethane-1,2-diol;2-fluoro-2-(4-nitrophenyl)acetic acid |
|---|---|
| PubChem CID | 175270208 |
| Molecular Formula | C10H12FNO6 |
| Molecular Weight | 261.20 g/mol |
| Exact Mass | 261.06 |
| IUPAC Name | ethane-1,2-diol;2-fluoro-2-(4-nitrophenyl)acetic acid |
| SMILES | O=C(O)C(F)c1ccc([N+](=O)[O-])cc1.OCCO |
| InChI | InChI=1S/C8H6FNO4.C2H6O2/c9-7(8(11)12)5-1-3-6(4-2-5)10(13)14;3-1-2-4/h1-4,7H,(H,11,12);3-4H,1-2H2 |
| InChIKey | URFAYUGDIWNWLY-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 120.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.20 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|