C23H26F3NO7 — CID 175270384
N-ethoxy-2-[2-ethyl-3,5-dihydroxy-6-[4-(trifluoromethoxy)benzoyl]phenyl]-N-(2-methoxyethyl)acetamide (PubChem CID 175270384) has the molecular formula C23H26F3NO7 and a molecular weight of 485.46 g/mol. Its IUPAC name is N-ethoxy-2-[2-ethyl-3,5-dihydroxy-6-[4-(trifluoromethoxy)benzoyl]phenyl]-N-(2-methoxyethyl)acetamide.
| Compound Name | N-ethoxy-2-[2-ethyl-3,5-dihydroxy-6-[4-(trifluoromethoxy)benzoyl]phenyl]-N-(2-methoxyethyl)acetamide |
|---|---|
| PubChem CID | 175270384 |
| Molecular Formula | C23H26F3NO7 |
| Molecular Weight | 485.46 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | N-ethoxy-2-[2-ethyl-3,5-dihydroxy-6-[4-(trifluoromethoxy)benzoyl]phenyl]-N-(2-methoxyethyl)acetamide |
| SMILES | CCON(CCOC)C(=O)Cc1c(CC)c(O)cc(O)c1C(=O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C23H26F3NO7/c1-4-16-17(12-20(30)27(33-5-2)10-11-32-3)21(19(29)13-18(16)28)22(31)14-6-8-15(9-7-14)34-23(24,25)26/h6-9,13,28-29H,4-5,10-12H2,1-3H3 |
| InChIKey | LIPDWOBLYBVQKO-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.46 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|