C14H26O4 — CID 175272434
6-(2-methylpropoxy)-2-(2-methylpropyl)-6-oxohexanoic acid (PubChem CID 175272434) has the molecular formula C14H26O4 and a molecular weight of 258.36 g/mol. Its IUPAC name is 6-(2-methylpropoxy)-2-(2-methylpropyl)-6-oxohexanoic acid.
| Compound Name | 6-(2-methylpropoxy)-2-(2-methylpropyl)-6-oxohexanoic acid |
|---|---|
| PubChem CID | 175272434 |
| Molecular Formula | C14H26O4 |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.18 |
| IUPAC Name | 6-(2-methylpropoxy)-2-(2-methylpropyl)-6-oxohexanoic acid |
| SMILES | CC(C)COC(=O)CCCC(CC(C)C)C(=O)O |
| InChI | InChI=1S/C14H26O4/c1-10(2)8-12(14(16)17)6-5-7-13(15)18-9-11(3)4/h10-12H,5-9H2,1-4H3,(H,16,17) |
| InChIKey | NCVSLBQSBDORFA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |