C10H14ClFN2 — CID 175273242
2-(3-chloro-4-fluorophenyl)-1,1-diethylhydrazine (PubChem CID 175273242) has the molecular formula C10H14ClFN2 and a molecular weight of 216.69 g/mol. Its IUPAC name is 2-(3-chloro-4-fluorophenyl)-1,1-diethylhydrazine.
| Compound Name | 2-(3-chloro-4-fluorophenyl)-1,1-diethylhydrazine |
|---|---|
| PubChem CID | 175273242 |
| Molecular Formula | C10H14ClFN2 |
| Molecular Weight | 216.69 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | 2-(3-chloro-4-fluorophenyl)-1,1-diethylhydrazine |
| SMILES | CCN(CC)Nc1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C10H14ClFN2/c1-3-14(4-2)13-8-5-6-10(12)9(11)7-8/h5-7,13H,3-4H2,1-2H3 |
| InChIKey | ZFRMFMXODXMUEN-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.69 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|