C23H21N3O3 — CID 175273695
methyl 4-[2-[4-(1,3-benzoxazol-2-yl)-2-hydrazinylphenyl]ethyl]benzoate (PubChem CID 175273695) has the molecular formula C23H21N3O3 and a molecular weight of 387.44 g/mol. Its IUPAC name is methyl 4-[2-[4-(1,3-benzoxazol-2-yl)-2-hydrazinylphenyl]ethyl]benzoate.
| Compound Name | methyl 4-[2-[4-(1,3-benzoxazol-2-yl)-2-hydrazinylphenyl]ethyl]benzoate |
|---|---|
| PubChem CID | 175273695 |
| Molecular Formula | C23H21N3O3 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | methyl 4-[2-[4-(1,3-benzoxazol-2-yl)-2-hydrazinylphenyl]ethyl]benzoate |
| SMILES | COC(=O)c1ccc(CCc2ccc(-c3nc4ccccc4o3)cc2NN)cc1 |
| InChI | InChI=1S/C23H21N3O3/c1-28-23(27)17-10-7-15(8-11-17)6-9-16-12-13-18(14-20(16)26-24)22-25-19-4-2-3-5-21(19)29-22/h2-5,7-8,10-14,26H,6,9,24H2,1H3 |
| InChIKey | FVLKPVGFDWIVKT-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|