C10H22ClNO4 — CID 175280130
2-hydroxybut-2-enoic acid;3-hydroxypropyl(trimethyl)azanium;chloride (PubChem CID 175280130) has the molecular formula C10H22ClNO4 and a molecular weight of 255.74 g/mol. Its IUPAC name is 2-hydroxybut-2-enoic acid;3-hydroxypropyl(trimethyl)azanium;chloride.
| Compound Name | 2-hydroxybut-2-enoic acid;3-hydroxypropyl(trimethyl)azanium;chloride |
|---|---|
| PubChem CID | 175280130 |
| Molecular Formula | C10H22ClNO4 |
| Molecular Weight | 255.74 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 2-hydroxybut-2-enoic acid;3-hydroxypropyl(trimethyl)azanium;chloride |
| SMILES | CC=C(O)C(=O)O.C[N+](C)(C)CCCO.[Cl-] |
| InChI | InChI=1S/C6H16NO.C4H6O3.ClH/c1-7(2,3)5-4-6-8;1-2-3(5)4(6)7;/h8H,4-6H2,1-3H3;2,5H,1H3,(H,6,7);1H/q+1;;/p-1 |
| InChIKey | SGIHTNVJAKIRGQ-UHFFFAOYSA-M |
| XLogP | -2.39 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.74 |
| LogP ≤ 5 | -2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|