C13H20FN — CID 175283011
1-(4,4-dimethylcyclohexyl)-3-fluoro-2-methylpyrrole (PubChem CID 175283011) has the molecular formula C13H20FN and a molecular weight of 209.31 g/mol. Its IUPAC name is 1-(4,4-dimethylcyclohexyl)-3-fluoro-2-methylpyrrole.
| Compound Name | 1-(4,4-dimethylcyclohexyl)-3-fluoro-2-methylpyrrole |
|---|---|
| PubChem CID | 175283011 |
| Molecular Formula | C13H20FN |
| Molecular Weight | 209.31 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | 1-(4,4-dimethylcyclohexyl)-3-fluoro-2-methylpyrrole |
| SMILES | Cc1c(F)ccn1C1CCC(C)(C)CC1 |
| InChI | InChI=1S/C13H20FN/c1-10-12(14)6-9-15(10)11-4-7-13(2,3)8-5-11/h6,9,11H,4-5,7-8H2,1-3H3 |
| InChIKey | TYQCLGXGDVKGDS-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.31 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |