About 1-chloropentane;hex-5-en-3-one
1-chloropentane;hex-5-en-3-one (PubChem CID 175286224) has the molecular formula C11H21ClO
and a molecular weight of 204.74 g/mol. Its IUPAC name is 1-chloropentane;hex-5-en-3-one.
Molecular Properties
| Compound Name | 1-chloropentane;hex-5-en-3-one |
| PubChem CID | 175286224 |
| Molecular Formula | C11H21ClO |
| Molecular Weight | 204.74 g/mol |
| Exact Mass | 204.13 |
| IUPAC Name | 1-chloropentane;hex-5-en-3-one |
| SMILES | C=CCC(=O)CC.CCCCCCl |
| InChI | InChI=1S/C6H10O.C5H11Cl/c1-3-5-6(7)4-2;1-2-3-4-5-6/h3H,1,4-5H2,2H3;2-5H2,1H3 |
| InChIKey | WEGPCAXZACGQFX-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.74 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-chloropentane;hex-5-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloropentane;hex-5-en-3-one?
The IUPAC name of 1-chloropentane;hex-5-en-3-one (CID 175286224) is 1-chloropentane;hex-5-en-3-one.
What is the SMILES notation for 1-chloropentane;hex-5-en-3-one?
The canonical SMILES for 1-chloropentane;hex-5-en-3-one is C=CCC(=O)CC.CCCCCCl.
What is the InChIKey of 1-chloropentane;hex-5-en-3-one?
The InChIKey is WEGPCAXZACGQFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O.C5H11Cl/c1-3-5-6(7)4-2;1-2-3-4-5-6/h3H,1,4-5H2,2H3;2-5H2,1H3.
What are the key properties of 1-chloropentane;hex-5-en-3-one?
1-chloropentane;hex-5-en-3-one has a molecular weight of 204.74 g/mol, XLogP of 3.96, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloropentane;hex-5-en-3-one is sourced from PubChem (CID 175286224), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).