C12H21ClO5 — CID 174507210
1-chloropentane;2-hydroxy-2-prop-2-enylbutanedioic acid (PubChem CID 174507210) has the molecular formula C12H21ClO5 and a molecular weight of 280.75 g/mol. Its IUPAC name is 1-chloropentane;2-hydroxy-2-prop-2-enylbutanedioic acid.
| Compound Name | 1-chloropentane;2-hydroxy-2-prop-2-enylbutanedioic acid |
|---|---|
| PubChem CID | 174507210 |
| Molecular Formula | C12H21ClO5 |
| Molecular Weight | 280.75 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 1-chloropentane;2-hydroxy-2-prop-2-enylbutanedioic acid |
| SMILES | C=CCC(O)(CC(=O)O)C(=O)O.CCCCCCl |
| InChI | InChI=1S/C7H10O5.C5H11Cl/c1-2-3-7(12,6(10)11)4-5(8)9;1-2-3-4-5-6/h2,12H,1,3-4H2,(H,8,9)(H,10,11);2-5H2,1H3 |
| InChIKey | AJCVXLCOWHESMR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 94.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.75 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|