C14H25O7Zn- — CID 175369436
2-hydroxypropane-1,2,3-tricarboxylic acid;octane;zinc (PubChem CID 175369436) has the molecular formula C14H25O7Zn- and a molecular weight of 370.74 g/mol. Its IUPAC name is 2-hydroxypropane-1,2,3-tricarboxylic acid;octane;zinc.
| Compound Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;octane;zinc |
|---|---|
| PubChem CID | 175369436 |
| Molecular Formula | C14H25O7Zn- |
| Molecular Weight | 370.74 g/mol |
| Exact Mass | 369.09 |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;octane;zinc |
| SMILES | O=C(O)CC(O)(CC(=O)O)C(=O)O.[CH2-]CCCCCCC.[Zn] |
| InChI | InChI=1S/C8H17.C6H8O7.Zn/c1-3-5-7-8-6-4-2;7-3(8)1-6(13,5(11)12)2-4(9)10;/h1,3-8H2,2H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);/q-1;; |
| InChIKey | KGIGNCQVGKWUHW-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.74 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|