C24H47NO7 — CID 88686314
N,N-dimethylhexadecan-1-amine;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 88686314) has the molecular formula C24H47NO7 and a molecular weight of 461.64 g/mol. Its IUPAC name is N,N-dimethylhexadecan-1-amine;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | N,N-dimethylhexadecan-1-amine;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 88686314 |
| Molecular Formula | C24H47NO7 |
| Molecular Weight | 461.64 g/mol |
| Exact Mass | 461.34 |
| IUPAC Name | N,N-dimethylhexadecan-1-amine;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | CCCCCCCCCCCCCCCCN(C)C.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C18H39N.C6H8O7/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(2)3;7-3(8)1-6(13,5(11)12)2-4(9)10/h4-18H2,1-3H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | OGNRGGBSODEXCW-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 135.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.64 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|