C18H35NO7 — CID 87904249
N,N-dibutylbutan-1-amine;2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 87904249) has the molecular formula C18H35NO7 and a molecular weight of 377.48 g/mol. Its IUPAC name is N,N-dibutylbutan-1-amine;2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | N,N-dibutylbutan-1-amine;2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 87904249 |
| Molecular Formula | C18H35NO7 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.24 |
| IUPAC Name | N,N-dibutylbutan-1-amine;2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | CCCCN(CCCC)CCCC.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C12H27N.C6H8O7/c1-4-7-10-13(11-8-5-2)12-9-6-3;7-3(8)1-6(13,5(11)12)2-4(9)10/h4-12H2,1-3H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | IPEGATJTMKHXLF-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 135.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |