C22H46N2O7 — CID 173418121
bis(N-butylbutan-1-amine);2-hydroxypropane-1,2,3-tricarboxylic acid (PubChem CID 173418121) has the molecular formula C22H46N2O7 and a molecular weight of 450.62 g/mol. Its IUPAC name is bis(N-butylbutan-1-amine);2-hydroxypropane-1,2,3-tricarboxylic acid.
| Compound Name | bis(N-butylbutan-1-amine);2-hydroxypropane-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 173418121 |
| Molecular Formula | C22H46N2O7 |
| Molecular Weight | 450.62 g/mol |
| Exact Mass | 450.33 |
| IUPAC Name | bis(N-butylbutan-1-amine);2-hydroxypropane-1,2,3-tricarboxylic acid |
| SMILES | CCCCNCCCC.CCCCNCCCC.O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/2C8H19N.C6H8O7/c2*1-3-5-7-9-8-6-4-2;7-3(8)1-6(13,5(11)12)2-4(9)10/h2*9H,3-8H2,1-2H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12) |
| InChIKey | JMVJTDSUMHTACN-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 156.19 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.62 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|