C18H25NO6S2 — CID 175286723
3-[2-methoxy-5-[[3-(2-methylpropyl)-2,4-dioxo-1,3-thiazolidin-5-yl]methyl]phenyl]propane-1-sulfonic acid (PubChem CID 175286723) has the molecular formula C18H25NO6S2 and a molecular weight of 415.53 g/mol. Its IUPAC name is 3-[2-methoxy-5-[[3-(2-methylpropyl)-2,4-dioxo-1,3-thiazolidin-5-yl]methyl]phenyl]propane-1-sulfonic acid.
| Compound Name | 3-[2-methoxy-5-[[3-(2-methylpropyl)-2,4-dioxo-1,3-thiazolidin-5-yl]methyl]phenyl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 175286723 |
| Molecular Formula | C18H25NO6S2 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.11 |
| IUPAC Name | 3-[2-methoxy-5-[[3-(2-methylpropyl)-2,4-dioxo-1,3-thiazolidin-5-yl]methyl]phenyl]propane-1-sulfonic acid |
| SMILES | COc1ccc(CC2SC(=O)N(CC(C)C)C2=O)cc1CCCS(=O)(=O)O |
| InChI | InChI=1S/C18H25NO6S2/c1-12(2)11-19-17(20)16(26-18(19)21)10-13-6-7-15(25-3)14(9-13)5-4-8-27(22,23)24/h6-7,9,12,16H,4-5,8,10-11H2,1-3H3,(H,22,23,24) |
| InChIKey | RLTZFROCPIHRBQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|