C14H24NO5S+ — CID 164708028
(3,4-dimethoxyphenyl)methyl-dimethyl-(3-sulfopropyl)azanium (PubChem CID 164708028) has the molecular formula C14H24NO5S+ and a molecular weight of 318.42 g/mol. Its IUPAC name is (3,4-dimethoxyphenyl)methyl-dimethyl-(3-sulfopropyl)azanium.
| Compound Name | (3,4-dimethoxyphenyl)methyl-dimethyl-(3-sulfopropyl)azanium |
|---|---|
| PubChem CID | 164708028 |
| Molecular Formula | C14H24NO5S+ |
| Molecular Weight | 318.42 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | (3,4-dimethoxyphenyl)methyl-dimethyl-(3-sulfopropyl)azanium |
| SMILES | COc1ccc(C[N+](C)(C)CCCS(=O)(=O)O)cc1OC |
| InChI | InChI=1S/C14H23NO5S/c1-15(2,8-5-9-21(16,17)18)11-12-6-7-13(19-3)14(10-12)20-4/h6-7,10H,5,8-9,11H2,1-4H3/p+1 |
| InChIKey | WUPFKMNUUONPCH-UHFFFAOYSA-O |
| XLogP | 1.56 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.42 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|