C18H32N2O2S — CID 175287740
tert-butyl N-decan-3-yl-N-(1,3-thiazol-5-yl)carbamate (PubChem CID 175287740) has the molecular formula C18H32N2O2S and a molecular weight of 340.53 g/mol. Its IUPAC name is tert-butyl N-decan-3-yl-N-(1,3-thiazol-5-yl)carbamate.
| Compound Name | tert-butyl N-decan-3-yl-N-(1,3-thiazol-5-yl)carbamate |
|---|---|
| PubChem CID | 175287740 |
| Molecular Formula | C18H32N2O2S |
| Molecular Weight | 340.53 g/mol |
| Exact Mass | 340.22 |
| IUPAC Name | tert-butyl N-decan-3-yl-N-(1,3-thiazol-5-yl)carbamate |
| SMILES | CCCCCCCC(CC)N(C(=O)OC(C)(C)C)c1cncs1 |
| InChI | InChI=1S/C18H32N2O2S/c1-6-8-9-10-11-12-15(7-2)20(16-13-19-14-23-16)17(21)22-18(3,4)5/h13-15H,6-12H2,1-5H3 |
| InChIKey | LVTDOCFLORGDQU-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.53 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|