C13H24N2O11S — CID 175288472
methyl (2R,3R,4S)-3-acetamido-4-amino-2-[(1R,2R)-2,3-dihydroxy-1-methoxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate;sulfuric acid (PubChem CID 175288472) has the molecular formula C13H24N2O11S and a molecular weight of 416.41 g/mol. Its IUPAC name is methyl (2R,3R,4S)-3-acetamido-4-amino-2-[(1R,2R)-2,3-dihydroxy-1-methoxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate;sulfuric acid.
| Compound Name | methyl (2R,3R,4S)-3-acetamido-4-amino-2-[(1R,2R)-2,3-dihydroxy-1-methoxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate;sulfuric acid |
|---|---|
| PubChem CID | 175288472 |
| Molecular Formula | C13H24N2O11S |
| Molecular Weight | 416.41 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | methyl (2R,3R,4S)-3-acetamido-4-amino-2-[(1R,2R)-2,3-dihydroxy-1-methoxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate;sulfuric acid |
| SMILES | COC(=O)C1=C[C@H](N)[C@@H](NC(C)=O)[C@H]([C@H](OC)[C@H](O)CO)O1.O=S(=O)(O)O |
| InChI | InChI=1S/C13H22N2O7.H2O4S/c1-6(17)15-10-7(14)4-9(13(19)21-3)22-12(10)11(20-2)8(18)5-16;1-5(2,3)4/h4,7-8,10-12,16,18H,5,14H2,1-3H3,(H,15,17);(H2,1,2,3,4)/t7-,8+,10+,11+,12+;/m0./s1 |
| InChIKey | UEPWILIEJPKKEN-VTSRNBTQSA-N |
| XLogP | -3.01 |
| TPSA | 214.94 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.41 |
| LogP ≤ 5 | -3.01 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|