C22H36N4O9 — CID 90277635
[1-[(2S)-2-amino-3-methylbutanoyl]oxycyclopropyl] (2R,3R,4S)-3-acetamido-4-(1-aminoethenylamino)-2-[(1S,2R)-2,3-dihydroxy-1-methoxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate (PubChem CID 90277635) has the molecular formula C22H36N4O9 and a molecular weight of 500.55 g/mol. Its IUPAC name is [1-[(2S)-2-amino-3-methylbutanoyl]oxycyclopropyl] (2R,3R,4S)-3-acetamido-4-(1-aminoethenylamino)-2-[(1S,2R)-2,3-dihydroxy-1-methoxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate.
| Compound Name | [1-[(2S)-2-amino-3-methylbutanoyl]oxycyclopropyl] (2R,3R,4S)-3-acetamido-4-(1-aminoethenylamino)-2-[(1S,2R)-2,3-dihydroxy-1-methoxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate |
|---|---|
| PubChem CID | 90277635 |
| Molecular Formula | C22H36N4O9 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | [1-[(2S)-2-amino-3-methylbutanoyl]oxycyclopropyl] (2R,3R,4S)-3-acetamido-4-(1-aminoethenylamino)-2-[(1S,2R)-2,3-dihydroxy-1-methoxypropyl]-3,4-dihydro-2H-pyran-6-carboxylate |
| SMILES | C=C(N)N[C@H]1C=C(C(=O)OC2(OC(=O)[C@@H](N)C(C)C)CC2)O[C@@H]([C@@H](OC)[C@H](O)CO)[C@@H]1NC(C)=O |
| InChI | InChI=1S/C22H36N4O9/c1-10(2)16(24)21(31)35-22(6-7-22)34-20(30)15-8-13(25-11(3)23)17(26-12(4)28)19(33-15)18(32-5)14(29)9-27/h8,10,13-14,16-19,25,27,29H,3,6-7,9,23-24H2,1-2,4-5H3,(H,26,28)/t13-,14+,16-,17+,18-,19+/m0/s1 |
| InChIKey | RJVDVLLUWMFXQM-SFGZTYNLSA-N |
| XLogP | -1.91 |
| TPSA | 204.69 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|