About acetonitrile;chloromethyl butanoate
acetonitrile;chloromethyl butanoate (PubChem CID 175291971) has the molecular formula C7H12ClNO2
and a molecular weight of 177.63 g/mol. Its IUPAC name is acetonitrile;chloromethyl butanoate.
Molecular Properties
| Compound Name | acetonitrile;chloromethyl butanoate |
| PubChem CID | 175291971 |
| Molecular Formula | C7H12ClNO2 |
| Molecular Weight | 177.63 g/mol |
| Exact Mass | 177.06 |
| IUPAC Name | acetonitrile;chloromethyl butanoate |
| SMILES | CC#N.CCCC(=O)OCCl |
| InChI | InChI=1S/C5H9ClO2.C2H3N/c1-2-3-5(7)8-4-6;1-2-3/h2-4H2,1H3;1H3 |
| InChIKey | ZDZIJCHLPTVLKN-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.63 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze acetonitrile;chloromethyl butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;chloromethyl butanoate?
The IUPAC name of acetonitrile;chloromethyl butanoate (CID 175291971) is acetonitrile;chloromethyl butanoate.
What is the SMILES notation for acetonitrile;chloromethyl butanoate?
The canonical SMILES for acetonitrile;chloromethyl butanoate is CC#N.CCCC(=O)OCCl.
What is the InChIKey of acetonitrile;chloromethyl butanoate?
The InChIKey is ZDZIJCHLPTVLKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9ClO2.C2H3N/c1-2-3-5(7)8-4-6;1-2-3/h2-4H2,1H3;1H3.
What are the key properties of acetonitrile;chloromethyl butanoate?
acetonitrile;chloromethyl butanoate has a molecular weight of 177.63 g/mol, XLogP of 2.06, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;chloromethyl butanoate is sourced from PubChem (CID 175291971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).