C22H25N5O3 — CID 175294056
N-[1-[3-[2-(3,5-dimethoxyphenyl)ethynyl]-1,2,4,6-tetrahydropyrrolo[3,4-d]pyrimidin-4-yl]azetidin-3-yl]prop-2-enamide (PubChem CID 175294056) has the molecular formula C22H25N5O3 and a molecular weight of 407.47 g/mol. Its IUPAC name is N-[1-[3-[2-(3,5-dimethoxyphenyl)ethynyl]-1,2,4,6-tetrahydropyrrolo[3,4-d]pyrimidin-4-yl]azetidin-3-yl]prop-2-enamide.
| Compound Name | N-[1-[3-[2-(3,5-dimethoxyphenyl)ethynyl]-1,2,4,6-tetrahydropyrrolo[3,4-d]pyrimidin-4-yl]azetidin-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 175294056 |
| Molecular Formula | C22H25N5O3 |
| Molecular Weight | 407.47 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | N-[1-[3-[2-(3,5-dimethoxyphenyl)ethynyl]-1,2,4,6-tetrahydropyrrolo[3,4-d]pyrimidin-4-yl]azetidin-3-yl]prop-2-enamide |
| SMILES | C=CC(=O)NC1CN(C2c3c[nH]cc3NCN2C#Cc2cc(OC)cc(OC)c2)C1 |
| InChI | InChI=1S/C22H25N5O3/c1-4-21(28)25-16-12-27(13-16)22-19-10-23-11-20(19)24-14-26(22)6-5-15-7-17(29-2)9-18(8-15)30-3/h4,7-11,16,22-24H,1,12-14H2,2-3H3,(H,25,28) |
| InChIKey | KLODCMNNHROQGF-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.47 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|