About 2-(2-aminoethyldisulfanyl)ethanamine;4-chlorobutanoyl chloride
2-(2-aminoethyldisulfanyl)ethanamine;4-chlorobutanoyl chloride (PubChem CID 175295628) has the molecular formula C8H18Cl2N2OS2
and a molecular weight of 293.29 g/mol. Its IUPAC name is 2-(2-aminoethyldisulfanyl)ethanamine;4-chlorobutanoyl chloride.
Molecular Properties
| Compound Name | 2-(2-aminoethyldisulfanyl)ethanamine;4-chlorobutanoyl chloride |
| PubChem CID | 175295628 |
| Molecular Formula | C8H18Cl2N2OS2 |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 292.02 |
| IUPAC Name | 2-(2-aminoethyldisulfanyl)ethanamine;4-chlorobutanoyl chloride |
| SMILES | NCCSSCCN.O=C(Cl)CCCCl |
| InChI | InChI=1S/C4H6Cl2O.C4H12N2S2/c5-3-1-2-4(6)7;5-1-3-7-8-4-2-6/h1-3H2;1-6H2 |
| InChIKey | BYDOGFPQFXOCFS-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-aminoethyldisulfanyl)ethanamine;4-chlorobutanoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-aminoethyldisulfanyl)ethanamine;4-chlorobutanoyl chloride?
The IUPAC name of 2-(2-aminoethyldisulfanyl)ethanamine;4-chlorobutanoyl chloride (CID 175295628) is 2-(2-aminoethyldisulfanyl)ethanamine;4-chlorobutanoyl chloride.
What is the SMILES notation for 2-(2-aminoethyldisulfanyl)ethanamine;4-chlorobutanoyl chloride?
The canonical SMILES for 2-(2-aminoethyldisulfanyl)ethanamine;4-chlorobutanoyl chloride is NCCSSCCN.O=C(Cl)CCCCl.
What is the InChIKey of 2-(2-aminoethyldisulfanyl)ethanamine;4-chlorobutanoyl chloride?
The InChIKey is BYDOGFPQFXOCFS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6Cl2O.C4H12N2S2/c5-3-1-2-4(6)7;5-1-3-7-8-4-2-6/h1-3H2;1-6H2.
What are the key properties of 2-(2-aminoethyldisulfanyl)ethanamine;4-chlorobutanoyl chloride?
2-(2-aminoethyldisulfanyl)ethanamine;4-chlorobutanoyl chloride has a molecular weight of 293.29 g/mol, XLogP of 2.06, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminoethyldisulfanyl)ethanamine;4-chlorobutanoyl chloride is sourced from PubChem (CID 175295628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).