About 12-chlorododecanoyl chloride;dimethylsilane;3-triethoxysilylpropan-1-amine
12-chlorododecanoyl chloride;dimethylsilane;3-triethoxysilylpropan-1-amine (PubChem CID 157096772) has the molecular formula C23H53Cl2NO4Si2
and a molecular weight of 534.76 g/mol. Its IUPAC name is 12-chlorododecanoyl chloride;dimethylsilane;3-triethoxysilylpropan-1-amine.
Molecular Properties
| Compound Name | 12-chlorododecanoyl chloride;dimethylsilane;3-triethoxysilylpropan-1-amine |
| PubChem CID | 157096772 |
| Molecular Formula | C23H53Cl2NO4Si2 |
| Molecular Weight | 534.76 g/mol |
| Exact Mass | 533.29 |
| IUPAC Name | 12-chlorododecanoyl chloride;dimethylsilane;3-triethoxysilylpropan-1-amine |
| SMILES | CCO[Si](CCCN)(OCC)OCC.C[SiH2]C.O=C(Cl)CCCCCCCCCCCCl |
| InChI | InChI=1S/C12H22Cl2O.C9H23NO3Si.C2H8Si/c13-11-9-7-5-3-1-2-4-6-8-10-12(14)15;1-4-11-14(12-5-2,13-6-3)9-7-8-10;1-3-2/h1-11H2;4-10H2,1-3H3;3H2,1-2H3 |
| InChIKey | AFHKEDTVTXISJG-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 534.76 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 12-chlorododecanoyl chloride;dimethylsilane;3-triethoxysilylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12-chlorododecanoyl chloride;dimethylsilane;3-triethoxysilylpropan-1-amine?
The IUPAC name of 12-chlorododecanoyl chloride;dimethylsilane;3-triethoxysilylpropan-1-amine (CID 157096772) is 12-chlorododecanoyl chloride;dimethylsilane;3-triethoxysilylpropan-1-amine.
What is the SMILES notation for 12-chlorododecanoyl chloride;dimethylsilane;3-triethoxysilylpropan-1-amine?
The canonical SMILES for 12-chlorododecanoyl chloride;dimethylsilane;3-triethoxysilylpropan-1-amine is CCO[Si](CCCN)(OCC)OCC.C[SiH2]C.O=C(Cl)CCCCCCCCCCCCl.
What is the InChIKey of 12-chlorododecanoyl chloride;dimethylsilane;3-triethoxysilylpropan-1-amine?
The InChIKey is AFHKEDTVTXISJG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22Cl2O.C9H23NO3Si.C2H8Si/c13-11-9-7-5-3-1-2-4-6-8-10-12(14)15;1-4-11-14(12-5-2,13-6-3)9-7-8-10;1-3-2/h1-11H2;4-10H2,1-3H3;3H2,1-2H3.
What are the key properties of 12-chlorododecanoyl chloride;dimethylsilane;3-triethoxysilylpropan-1-amine?
12-chlorododecanoyl chloride;dimethylsilane;3-triethoxysilylpropan-1-amine has a molecular weight of 534.76 g/mol, XLogP of 6.53, 20 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 12-chlorododecanoyl chloride;dimethylsilane;3-triethoxysilylpropan-1-amine is sourced from PubChem (CID 157096772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).