About (Z)-octadec-9-enoic acid;3-triethoxysilylpropan-1-amine
(Z)-octadec-9-enoic acid;3-triethoxysilylpropan-1-amine (PubChem CID 175228614) has the molecular formula C27H57NO5Si
and a molecular weight of 503.84 g/mol. Its IUPAC name is (Z)-octadec-9-enoic acid;3-triethoxysilylpropan-1-amine.
Molecular Properties
| Compound Name | (Z)-octadec-9-enoic acid;3-triethoxysilylpropan-1-amine |
| PubChem CID | 175228614 |
| Molecular Formula | C27H57NO5Si |
| Molecular Weight | 503.84 g/mol |
| Exact Mass | 503.40 |
| IUPAC Name | (Z)-octadec-9-enoic acid;3-triethoxysilylpropan-1-amine |
| SMILES | CCCCCCCC/C=C\CCCCCCCC(=O)O.CCO[Si](CCCN)(OCC)OCC |
| InChI | InChI=1S/C18H34O2.C9H23NO3Si/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-4-11-14(12-5-2,13-6-3)9-7-8-10/h9-10H,2-8,11-17H2,1H3,(H,19,20);4-10H2,1-3H3/b10-9-; |
| InChIKey | OPLNXSSVMWEIRH-KVVVOXFISA-N |
| XLogP | 7.49 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 503.84 |
| LogP ≤ 5 | 7.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-octadec-9-enoic acid;3-triethoxysilylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-octadec-9-enoic acid;3-triethoxysilylpropan-1-amine?
The IUPAC name of (Z)-octadec-9-enoic acid;3-triethoxysilylpropan-1-amine (CID 175228614) is (Z)-octadec-9-enoic acid;3-triethoxysilylpropan-1-amine.
What is the SMILES notation for (Z)-octadec-9-enoic acid;3-triethoxysilylpropan-1-amine?
The canonical SMILES for (Z)-octadec-9-enoic acid;3-triethoxysilylpropan-1-amine is CCCCCCCC/C=C\CCCCCCCC(=O)O.CCO[Si](CCCN)(OCC)OCC.
What is the InChIKey of (Z)-octadec-9-enoic acid;3-triethoxysilylpropan-1-amine?
The InChIKey is OPLNXSSVMWEIRH-KVVVOXFISA-N. The full InChI is InChI=1S/C18H34O2.C9H23NO3Si/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-4-11-14(12-5-2,13-6-3)9-7-8-10/h9-10H,2-8,11-17H2,1H3,(H,19,20);4-10H2,1-3H3/b10-9-;.
What are the key properties of (Z)-octadec-9-enoic acid;3-triethoxysilylpropan-1-amine?
(Z)-octadec-9-enoic acid;3-triethoxysilylpropan-1-amine has a molecular weight of 503.84 g/mol, XLogP of 7.49, 24 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-octadec-9-enoic acid;3-triethoxysilylpropan-1-amine is sourced from PubChem (CID 175228614), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).