About 3-chlorobenzoyl chloride;4-chlorobenzoyl chloride;4-chlorobutanoyl chloride
3-chlorobenzoyl chloride;4-chlorobenzoyl chloride;4-chlorobutanoyl chloride (PubChem CID 158459582) has the molecular formula C18H14Cl6O3
and a molecular weight of 491.03 g/mol. Its IUPAC name is 3-chlorobenzoyl chloride;4-chlorobenzoyl chloride;4-chlorobutanoyl chloride.
Molecular Properties
| Compound Name | 3-chlorobenzoyl chloride;4-chlorobenzoyl chloride;4-chlorobutanoyl chloride |
| PubChem CID | 158459582 |
| Molecular Formula | C18H14Cl6O3 |
| Molecular Weight | 491.03 g/mol |
| Exact Mass | 487.91 |
| IUPAC Name | 3-chlorobenzoyl chloride;4-chlorobenzoyl chloride;4-chlorobutanoyl chloride |
| SMILES | O=C(Cl)CCCCl.O=C(Cl)c1ccc(Cl)cc1.O=C(Cl)c1cccc(Cl)c1 |
| InChI | InChI=1S/2C7H4Cl2O.C4H6Cl2O/c8-6-3-1-5(2-4-6)7(9)10;8-6-3-1-2-5(4-6)7(9)10;5-3-1-2-4(6)7/h2*1-4H;1-3H2 |
| InChIKey | HEZPNRQQAKUFRN-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 491.03 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-chlorobenzoyl chloride;4-chlorobenzoyl chloride;4-chlorobutanoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chlorobenzoyl chloride;4-chlorobenzoyl chloride;4-chlorobutanoyl chloride?
The IUPAC name of 3-chlorobenzoyl chloride;4-chlorobenzoyl chloride;4-chlorobutanoyl chloride (CID 158459582) is 3-chlorobenzoyl chloride;4-chlorobenzoyl chloride;4-chlorobutanoyl chloride.
What is the SMILES notation for 3-chlorobenzoyl chloride;4-chlorobenzoyl chloride;4-chlorobutanoyl chloride?
The canonical SMILES for 3-chlorobenzoyl chloride;4-chlorobenzoyl chloride;4-chlorobutanoyl chloride is O=C(Cl)CCCCl.O=C(Cl)c1ccc(Cl)cc1.O=C(Cl)c1cccc(Cl)c1.
What is the InChIKey of 3-chlorobenzoyl chloride;4-chlorobenzoyl chloride;4-chlorobutanoyl chloride?
The InChIKey is HEZPNRQQAKUFRN-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H4Cl2O.C4H6Cl2O/c8-6-3-1-5(2-4-6)7(9)10;8-6-3-1-2-5(4-6)7(9)10;5-3-1-2-4(6)7/h2*1-4H;1-3H2.
What are the key properties of 3-chlorobenzoyl chloride;4-chlorobenzoyl chloride;4-chlorobutanoyl chloride?
3-chlorobenzoyl chloride;4-chlorobenzoyl chloride;4-chlorobutanoyl chloride has a molecular weight of 491.03 g/mol, XLogP of 7.21, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chlorobenzoyl chloride;4-chlorobenzoyl chloride;4-chlorobutanoyl chloride is sourced from PubChem (CID 158459582), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).