About 3-chlorobenzoyl chloride;4-methylsulfonylbenzoyl chloride
3-chlorobenzoyl chloride;4-methylsulfonylbenzoyl chloride (PubChem CID 160723063) has the molecular formula C15H11Cl3O4S
and a molecular weight of 393.68 g/mol. Its IUPAC name is 3-chlorobenzoyl chloride;4-methylsulfonylbenzoyl chloride.
Molecular Properties
| Compound Name | 3-chlorobenzoyl chloride;4-methylsulfonylbenzoyl chloride |
| PubChem CID | 160723063 |
| Molecular Formula | C15H11Cl3O4S |
| Molecular Weight | 393.68 g/mol |
| Exact Mass | 391.94 |
| IUPAC Name | 3-chlorobenzoyl chloride;4-methylsulfonylbenzoyl chloride |
| SMILES | CS(=O)(=O)c1ccc(C(=O)Cl)cc1.O=C(Cl)c1cccc(Cl)c1 |
| InChI | InChI=1S/C8H7ClO3S.C7H4Cl2O/c1-13(11,12)7-4-2-6(3-5-7)8(9)10;8-6-3-1-2-5(4-6)7(9)10/h2-5H,1H3;1-4H |
| InChIKey | RTIUUTJWHGDPCI-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 393.68 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-chlorobenzoyl chloride;4-methylsulfonylbenzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chlorobenzoyl chloride;4-methylsulfonylbenzoyl chloride?
The IUPAC name of 3-chlorobenzoyl chloride;4-methylsulfonylbenzoyl chloride (CID 160723063) is 3-chlorobenzoyl chloride;4-methylsulfonylbenzoyl chloride.
What is the SMILES notation for 3-chlorobenzoyl chloride;4-methylsulfonylbenzoyl chloride?
The canonical SMILES for 3-chlorobenzoyl chloride;4-methylsulfonylbenzoyl chloride is CS(=O)(=O)c1ccc(C(=O)Cl)cc1.O=C(Cl)c1cccc(Cl)c1.
What is the InChIKey of 3-chlorobenzoyl chloride;4-methylsulfonylbenzoyl chloride?
The InChIKey is RTIUUTJWHGDPCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7ClO3S.C7H4Cl2O/c1-13(11,12)7-4-2-6(3-5-7)8(9)10;8-6-3-1-2-5(4-6)7(9)10/h2-5H,1H3;1-4H.
What are the key properties of 3-chlorobenzoyl chloride;4-methylsulfonylbenzoyl chloride?
3-chlorobenzoyl chloride;4-methylsulfonylbenzoyl chloride has a molecular weight of 393.68 g/mol, XLogP of 4.19, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chlorobenzoyl chloride;4-methylsulfonylbenzoyl chloride is sourced from PubChem (CID 160723063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).