C18H15ClO4S — CID 15383981
(3E)-3-[(3-chlorophenyl)-(4-methylsulfonylphenyl)methylidene]oxolan-2-one (PubChem CID 15383981) has the molecular formula C18H15ClO4S and a molecular weight of 362.83 g/mol. Its IUPAC name is (3E)-3-[(3-chlorophenyl)-(4-methylsulfonylphenyl)methylidene]oxolan-2-one.
| Compound Name | (3E)-3-[(3-chlorophenyl)-(4-methylsulfonylphenyl)methylidene]oxolan-2-one |
|---|---|
| PubChem CID | 15383981 |
| Molecular Formula | C18H15ClO4S |
| Molecular Weight | 362.83 g/mol |
| Exact Mass | 362.04 |
| IUPAC Name | (3E)-3-[(3-chlorophenyl)-(4-methylsulfonylphenyl)methylidene]oxolan-2-one |
| SMILES | CS(=O)(=O)c1ccc(/C(=C2/CCOC2=O)c2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C18H15ClO4S/c1-24(21,22)15-7-5-12(6-8-15)17(16-9-10-23-18(16)20)13-3-2-4-14(19)11-13/h2-8,11H,9-10H2,1H3/b17-16+ |
| InChIKey | SWQSXNPJMCRJFV-WUKNDPDISA-N |
| XLogP | 3.49 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.83 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|