C18H16F3NO2 — CID 175296769
[2,2-dimethyl-1-(2,4,5-trifluorophenyl)-3H-inden-1-yl] carbamate (PubChem CID 175296769) has the molecular formula C18H16F3NO2 and a molecular weight of 335.33 g/mol. Its IUPAC name is [2,2-dimethyl-1-(2,4,5-trifluorophenyl)-3H-inden-1-yl] carbamate.
| Compound Name | [2,2-dimethyl-1-(2,4,5-trifluorophenyl)-3H-inden-1-yl] carbamate |
|---|---|
| PubChem CID | 175296769 |
| Molecular Formula | C18H16F3NO2 |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | [2,2-dimethyl-1-(2,4,5-trifluorophenyl)-3H-inden-1-yl] carbamate |
| SMILES | CC1(C)Cc2ccccc2C1(OC(N)=O)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C18H16F3NO2/c1-17(2)9-10-5-3-4-6-11(10)18(17,24-16(22)23)12-7-14(20)15(21)8-13(12)19/h3-8H,9H2,1-2H3,(H2,22,23) |
| InChIKey | JDGKERIFROJVNR-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|