C22H25ClN4O — CID 175301099
2-methyl-N-phenyl-5-(piperidin-4-ylamino)quinoline-8-carboxamide;hydrochloride (PubChem CID 175301099) has the molecular formula C22H25ClN4O and a molecular weight of 396.92 g/mol. Its IUPAC name is 2-methyl-N-phenyl-5-(piperidin-4-ylamino)quinoline-8-carboxamide;hydrochloride.
| Compound Name | 2-methyl-N-phenyl-5-(piperidin-4-ylamino)quinoline-8-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 175301099 |
| Molecular Formula | C22H25ClN4O |
| Molecular Weight | 396.92 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 2-methyl-N-phenyl-5-(piperidin-4-ylamino)quinoline-8-carboxamide;hydrochloride |
| SMILES | Cc1ccc2c(NC3CCNCC3)ccc(C(=O)Nc3ccccc3)c2n1.Cl |
| InChI | InChI=1S/C22H24N4O.ClH/c1-15-7-8-18-20(25-17-11-13-23-14-12-17)10-9-19(21(18)24-15)22(27)26-16-5-3-2-4-6-16;/h2-10,17,23,25H,11-14H2,1H3,(H,26,27);1H |
| InChIKey | VTCUFFFCKCKZBZ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.92 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |