C11H24N4 — CID 175301929
3,6,8,15-tetrazabicyclo[9.3.1]pentadecane (PubChem CID 175301929) has the molecular formula C11H24N4 and a molecular weight of 212.34 g/mol. Its IUPAC name is 3,6,8,15-tetrazabicyclo[9.3.1]pentadecane.
| Compound Name | 3,6,8,15-tetrazabicyclo[9.3.1]pentadecane |
|---|---|
| PubChem CID | 175301929 |
| Molecular Formula | C11H24N4 |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.20 |
| IUPAC Name | 3,6,8,15-tetrazabicyclo[9.3.1]pentadecane |
| SMILES | C1CC2CCNCNCCNCC(C1)N2 |
| InChI | InChI=1S/C11H24N4/c1-2-10-4-5-13-9-14-7-6-12-8-11(3-1)15-10/h10-15H,1-9H2 |
| InChIKey | ZRSSNPRDPSORNL-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |