C14H15N4Na2O11P — CID 175302650
disodium;[4-[[(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy]-4-oxobutanoyl] phosphate (PubChem CID 175302650) has the molecular formula C14H15N4Na2O11P and a molecular weight of 492.25 g/mol. Its IUPAC name is disodium;[4-[[(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy]-4-oxobutanoyl] phosphate.
| Compound Name | disodium;[4-[[(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy]-4-oxobutanoyl] phosphate |
|---|---|
| PubChem CID | 175302650 |
| Molecular Formula | C14H15N4Na2O11P |
| Molecular Weight | 492.25 g/mol |
| Exact Mass | 492.03 |
| IUPAC Name | disodium;[4-[[(2R,3S,4R,5R)-3,4-dihydroxy-5-(6-oxo-1H-purin-9-yl)oxolan-2-yl]methoxy]-4-oxobutanoyl] phosphate |
| SMILES | O=C(CCC(=O)OP(=O)([O-])[O-])OC[C@H]1O[C@@H](n2cnc3c(=O)[nH]cnc32)[C@H](O)[C@@H]1O.[Na+].[Na+] |
| InChI | InChI=1S/C14H17N4O11P.2Na/c19-7(1-2-8(20)29-30(24,25)26)27-3-6-10(21)11(22)14(28-6)18-5-17-9-12(18)15-4-16-13(9)23;;/h4-6,10-11,14,21-22H,1-3H2,(H,15,16,23)(H2,24,25,26);;/q;2*+1/p-2/t6-,10-,11-,14-;;/m1../s1 |
| InChIKey | GXNAIXMQLULVMT-QJGLRIEYSA-L |
| XLogP | -9.56 |
| TPSA | 229.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.25 |
| LogP ≤ 5 | -9.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|