C27H40O2 — CID 175303430
2-[1-(2-hydroxy-6-pentylphenyl)-2,2-dimethylpropyl]-3-pentylphenol (PubChem CID 175303430) has the molecular formula C27H40O2 and a molecular weight of 396.62 g/mol. Its IUPAC name is 2-[1-(2-hydroxy-6-pentylphenyl)-2,2-dimethylpropyl]-3-pentylphenol.
| Compound Name | 2-[1-(2-hydroxy-6-pentylphenyl)-2,2-dimethylpropyl]-3-pentylphenol |
|---|---|
| PubChem CID | 175303430 |
| Molecular Formula | C27H40O2 |
| Molecular Weight | 396.62 g/mol |
| Exact Mass | 396.30 |
| IUPAC Name | 2-[1-(2-hydroxy-6-pentylphenyl)-2,2-dimethylpropyl]-3-pentylphenol |
| SMILES | CCCCCc1cccc(O)c1C(c1c(O)cccc1CCCCC)C(C)(C)C |
| InChI | InChI=1S/C27H40O2/c1-6-8-10-14-20-16-12-18-22(28)24(20)26(27(3,4)5)25-21(15-11-9-7-2)17-13-19-23(25)29/h12-13,16-19,26,28-29H,6-11,14-15H2,1-5H3 |
| InChIKey | UQMOWJSGXXYAEU-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.62 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|