C13H15N3O4 — CID 175303624
2-amino-3-phenylpropanoic acid;1,4-dihydropyrazine-2,3-dione (PubChem CID 175303624) has the molecular formula C13H15N3O4 and a molecular weight of 277.28 g/mol. Its IUPAC name is 2-amino-3-phenylpropanoic acid;1,4-dihydropyrazine-2,3-dione.
| Compound Name | 2-amino-3-phenylpropanoic acid;1,4-dihydropyrazine-2,3-dione |
|---|---|
| PubChem CID | 175303624 |
| Molecular Formula | C13H15N3O4 |
| Molecular Weight | 277.28 g/mol |
| Exact Mass | 277.11 |
| IUPAC Name | 2-amino-3-phenylpropanoic acid;1,4-dihydropyrazine-2,3-dione |
| SMILES | NC(Cc1ccccc1)C(=O)O.O=c1[nH]cc[nH]c1=O |
| InChI | InChI=1S/C9H11NO2.C4H4N2O2/c10-8(9(11)12)6-7-4-2-1-3-5-7;7-3-4(8)6-2-1-5-3/h1-5,8H,6,10H2,(H,11,12);1-2H,(H,5,7)(H,6,8) |
| InChIKey | BFEFDDSTLDFSHQ-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 129.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.28 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|