C21H16ClN3 — CID 175304154
1-chloro-2,3-diphenylbenzene;triazine (PubChem CID 175304154) has the molecular formula C21H16ClN3 and a molecular weight of 345.83 g/mol. Its IUPAC name is 1-chloro-2,3-diphenylbenzene;triazine.
| Compound Name | 1-chloro-2,3-diphenylbenzene;triazine |
|---|---|
| PubChem CID | 175304154 |
| Molecular Formula | C21H16ClN3 |
| Molecular Weight | 345.83 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 1-chloro-2,3-diphenylbenzene;triazine |
| SMILES | Clc1cccc(-c2ccccc2)c1-c1ccccc1.c1cnnnc1 |
| InChI | InChI=1S/C18H13Cl.C3H3N3/c19-17-13-7-12-16(14-8-3-1-4-9-14)18(17)15-10-5-2-6-11-15;1-2-4-6-5-3-1/h1-13H;1-3H |
| InChIKey | BEQDBHDKOCCXRJ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.83 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |