C13H24N2O4 — CID 175304656
[6-(hydroxymethyl)piperidin-3-yl]carbamoyl 3,3-dimethylbutanoate (PubChem CID 175304656) has the molecular formula C13H24N2O4 and a molecular weight of 272.34 g/mol. Its IUPAC name is [6-(hydroxymethyl)piperidin-3-yl]carbamoyl 3,3-dimethylbutanoate.
| Compound Name | [6-(hydroxymethyl)piperidin-3-yl]carbamoyl 3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 175304656 |
| Molecular Formula | C13H24N2O4 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | [6-(hydroxymethyl)piperidin-3-yl]carbamoyl 3,3-dimethylbutanoate |
| SMILES | CC(C)(C)CC(=O)OC(=O)NC1CCC(CO)NC1 |
| InChI | InChI=1S/C13H24N2O4/c1-13(2,3)6-11(17)19-12(18)15-9-4-5-10(8-16)14-7-9/h9-10,14,16H,4-8H2,1-3H3,(H,15,18) |
| InChIKey | PUDSEBZSDMBIHJ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|