C39H69NO3 — CID 175305646
N-hexyl-7-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-3-methyl-2-pentoxyoctanamide (PubChem CID 175305646) has the molecular formula C39H69NO3 and a molecular weight of 599.99 g/mol. Its IUPAC name is N-hexyl-7-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-3-methyl-2-pentoxyoctanamide.
| Compound Name | N-hexyl-7-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-3-methyl-2-pentoxyoctanamide |
|---|---|
| PubChem CID | 175305646 |
| Molecular Formula | C39H69NO3 |
| Molecular Weight | 599.99 g/mol |
| Exact Mass | 599.53 |
| IUPAC Name | N-hexyl-7-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-3-methyl-2-pentoxyoctanamide |
| SMILES | CCCCCCNC(=O)C(OCCCCC)C(C)CCCC(C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C39H69NO3/c1-7-9-11-12-25-40-37(42)36(43-26-13-10-8-2)29(4)16-14-15-28(3)33-19-20-34-32-18-17-30-27-31(41)21-23-38(30,5)35(32)22-24-39(33,34)6/h17,28-29,31-36,41H,7-16,18-27H2,1-6H3,(H,40,42)/t28?,29?,31-,32-,33+,34-,35-,36?,38-,39+/m0/s1 |
| InChIKey | PIYHUXSHDACPFV-WUINWBBESA-N |
| XLogP | 9.64 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.99 |
| LogP ≤ 5 | 9.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|