C34H59NO3 — CID 172746333
[(6R)-6-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptan-2-yl] N-hexylcarbamate (PubChem CID 172746333) has the molecular formula C34H59NO3 and a molecular weight of 529.85 g/mol. Its IUPAC name is [(6R)-6-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptan-2-yl] N-hexylcarbamate.
| Compound Name | [(6R)-6-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptan-2-yl] N-hexylcarbamate |
|---|---|
| PubChem CID | 172746333 |
| Molecular Formula | C34H59NO3 |
| Molecular Weight | 529.85 g/mol |
| Exact Mass | 529.45 |
| IUPAC Name | [(6R)-6-[(3S,8S,9S,10R,13R,14S,17R)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-2-methylheptan-2-yl] N-hexylcarbamate |
| SMILES | CCCCCCNC(=O)OC(C)(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC=C4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C34H59NO3/c1-7-8-9-10-22-35-31(37)38-32(3,4)19-11-12-24(2)28-15-16-29-27-14-13-25-23-26(36)17-20-33(25,5)30(27)18-21-34(28,29)6/h13,24,26-30,36H,7-12,14-23H2,1-6H3,(H,35,37)/t24-,26+,27+,28-,29+,30+,33+,34-/m1/s1 |
| InChIKey | JTTRFHATYHDXAM-NPIGIBJLSA-N |
| XLogP | 8.82 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.85 |
| LogP ≤ 5 | 8.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|